Difference between revisions of "NIACINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-2-thiouridine34 == * common-name: ** a 2-thiouridine34 in trna == Reaction(s) known to consume the compound == == Reaction(s) known...")
(Created page with "Category:metabolite == Metabolite CPD-17264 == * common-name: ** (2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNA-2-thiouridine34 ==
+
== Metabolite CPD-17264 ==
 
* common-name:
 
* common-name:
** a 2-thiouridine34 in trna
+
** (2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa
 +
* smiles:
 +
** ccc=ccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** ptromslvpfeiqj-qpyoymcksa-j
 +
* molecular-weight:
 +
** 1047.943
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16820]]
+
* [[RXN-16021]]
* [[RXN0-2023]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 2-thiouridine34 in trna}}
+
{{#set: common-name=(2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa}}
 +
{{#set: inchi-key=inchikey=ptromslvpfeiqj-qpyoymcksa-j}}
 +
{{#set: molecular-weight=1047.943}}

Revision as of 11:14, 15 January 2021

Metabolite CPD-17264

  • common-name:
    • (2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ptromslvpfeiqj-qpyoymcksa-j
  • molecular-weight:
    • 1047.943

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality