Difference between revisions of "NICOTINAMIDE NUCLEOTIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ22398 == * transcription-direction: ** negative * right-end-position: ** 175362 * left-end-position: ** 158942 * centisome-position: ** 89.64934...")
(Created page with "Category:metabolite == Metabolite NICOTINAMIDE_NUCLEOTIDE == * common-name: ** β-nicotinamide d-ribonucleotide * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ22398 ==
+
== Metabolite NICOTINAMIDE_NUCLEOTIDE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** β-nicotinamide d-ribonucleotide
−
* right-end-position:
+
* smiles:
−
** 175362
+
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
−
* left-end-position:
+
* inchi-key:
−
** 158942
+
** dayljwodmcoqew-turqnecasa-m
−
* centisome-position:
+
* molecular-weight:
−
** 89.64934   
+
** 333.214
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[2.7.7.1-RXN]]
−
== Reaction(s) associated ==
+
* [[RXN-5841]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to produce the compound ==
−
* [[H2NEOPTERINALDOL-RXN]]
+
* [[DNA-LIGASE-NAD+-RXN]]
−
** Category: [[annotation]]
+
* [[NADPYROPHOSPHAT-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-17920]]
−
* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=&beta;-nicotinamide d-ribonucleotide}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=dayljwodmcoqew-turqnecasa-m}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=333.214}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[H2PTEROATESYNTH-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-10857]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15733]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6797]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6148]]
 
−
** '''2''' reactions found over '''14''' reactions in the full pathway
 
−
* [[PWY-6147]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-7539]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-7853]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7852]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6614]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=175362}}
 
−
{{#set: left-end-position=158942}}
 
−
{{#set: centisome-position=89.64934    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=7}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite NICOTINAMIDE_NUCLEOTIDE

  • common-name:
    • β-nicotinamide d-ribonucleotide
  • smiles:
    • c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
  • inchi-key:
    • dayljwodmcoqew-turqnecasa-m
  • molecular-weight:
    • 333.214

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=NICOTINAMIDE_NUCLEOTIDE&oldid=136643"