Difference between revisions of "NICOTINAMIDE NUCLEOTIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HCO3 == * common-name: ** hydrogencarbonate * smiles: ** c([o-])(=o)o * inchi-key: ** bvkzguzccusvtd-uhfffaoysa-m * molecular-weight: **...") |
(Created page with "Category:metabolite == Metabolite NICOTINAMIDE_NUCLEOTIDE == * common-name: ** β-nicotinamide d-ribonucleotide * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite NICOTINAMIDE_NUCLEOTIDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-nicotinamide d-ribonucleotide |
* smiles: | * smiles: | ||
| − | ** c([o-])(=o)o | + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dayljwodmcoqew-turqnecasa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 333.214 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.7.7.1-RXN]] |
| − | + | * [[RXN-5841]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DNA-LIGASE-NAD+-RXN]] |
| − | + | * [[NADPYROPHOSPHAT-RXN]] | |
| − | + | * [[RXN-17920]] | |
| − | |||
| − | * [[RXN | ||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-nicotinamide d-ribonucleotide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dayljwodmcoqew-turqnecasa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=333.214}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite NICOTINAMIDE_NUCLEOTIDE
- common-name:
- β-nicotinamide d-ribonucleotide
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
- inchi-key:
- dayljwodmcoqew-turqnecasa-m
- molecular-weight:
- 333.214
