Difference between revisions of "NICOTINAMIDE NUCLEOTIDE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ14817 == * transcription-direction: ** negative * right-end-position: ** 292182 * left-end-position: ** 257886 * centisome-position: ** 64.258804...") |
(Created page with "Category:metabolite == Metabolite NICOTINAMIDE_NUCLEOTIDE == * common-name: ** β-nicotinamide d-ribonucleotide * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite NICOTINAMIDE_NUCLEOTIDE == |
| − | * | + | * common-name: |
| − | ** | + | ** β-nicotinamide d-ribonucleotide |
| − | * | + | * smiles: |
| − | ** | + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** dayljwodmcoqew-turqnecasa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 333.214 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[2.7.7.1-RXN]] | |
| − | == Reaction(s) | + | * [[RXN-5841]] |
| − | * [[2.7.1 | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[DNA-LIGASE-NAD+-RXN]] |
| − | + | * [[NADPYROPHOSPHAT-RXN]] | |
| − | == | + | * [[RXN-17920]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | * | + | {{#set: common-name=β-nicotinamide d-ribonucleotide}} |
| − | * [[ | + | {{#set: inchi-key=inchikey=dayljwodmcoqew-turqnecasa-m}} |
| − | + | {{#set: molecular-weight=333.214}} | |
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite NICOTINAMIDE_NUCLEOTIDE
- common-name:
- β-nicotinamide d-ribonucleotide
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
- inchi-key:
- dayljwodmcoqew-turqnecasa-m
- molecular-weight:
- 333.214
