Difference between revisions of "NICOTINAMIDE NUCLEOTIDE"

Revision as of 15:24, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD1G-0 ==
+== Metabolite HCO3 ==
 * common-name:
-** 1-(2-amino-2-deoxy-&alpha;-d-glucopyranosyl)-1d-myo-inositol
+** hydrogencarbonate
 * smiles:
-** c(o)c2(c(c(c([n+])c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o)
+** c([o-])(=o)o
 * inchi-key:
-** hepuigaczyvucd-lfikjohqsa-o
+** bvkzguzccusvtd-uhfffaoysa-m
 * molecular-weight:
-** 342.322
+** 61.017
 == Reaction(s) known to consume the compound ==
-* [[RXN1G-121]]
+* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
+* [[BIOTIN-CARBOXYL-RXN]]
+* [[CARBPSYN-RXN]]
+* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
+* [[PCr]]
+* [[PEPCARBOX-RXN]]
+* [[PROPIONYL-COA-CARBOXY-RXN]]
+* [[PYRUVATE-CARBOXYLASE-RXN]]
+* [[R524-RXN]]
+* [[RXN-12893]]
+* [[RXN-13202]]
+* [[RXN-14569]]
+* [[RXN-16909]]
+* [[RXN0-5224]]
+* [[RXN1G-4355]]
 == Reaction(s) known to produce the compound ==
+* [[1.2.1.27-RXN]]
+* [[ACOACXr]]
+* [[PCr]]
+* [[PROPIONYL-COA-CARBOXY-RXN]]
+* [[RXN-11213]]
+* [[RXN-14569]]
+* [[RXN0-5224]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=1-(2-amino-2-deoxy-&alpha;-d-glucopyranosyl)-1d-myo-inositol}}
+{{#set: common-name=hydrogencarbonate}}
-{{#set: inchi-key=inchikey=hepuigaczyvucd-lfikjohqsa-o}}
+{{#set: inchi-key=inchikey=bvkzguzccusvtd-uhfffaoysa-m}}
-{{#set: molecular-weight=342.322}}
+{{#set: molecular-weight=61.017}}