Difference between revisions of "NICOTINAMIDE RIBOSE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12107 RXN-12107] == * direction: ** left-to-right * common-name: ** l-idonate 5-dehydrogenase *...") |
(Created page with "Category:metabolite == Metabolite NICOTINAMIDE_RIBOSE == * common-name: ** 1-(β-d ribofuranosyl)nicotinamide * smiles: ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2)...") |
||
| (8 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite NICOTINAMIDE_RIBOSE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 1-(β-d ribofuranosyl)nicotinamide |
| − | * | + | * smiles: |
| − | ** | + | ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2)) |
| − | + | * inchi-key: | |
| − | + | ** jlebzpbdrkpwtd-turqnecasa-o | |
| − | == | + | * molecular-weight: |
| − | * | + | ** 255.25 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | == Reaction(s) known to produce the compound == |
| − | == | + | * [[RXN-5841]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=1-(β-d ribofuranosyl)nicotinamide}} | |
| − | + | {{#set: inchi-key=inchikey=jlebzpbdrkpwtd-turqnecasa-o}} | |
| − | * | + | {{#set: molecular-weight=255.25}} |
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite NICOTINAMIDE_RIBOSE
- common-name:
- 1-(β-d ribofuranosyl)nicotinamide
- smiles:
- c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
- inchi-key:
- jlebzpbdrkpwtd-turqnecasa-o
- molecular-weight:
- 255.25
