Difference between revisions of "NICOTINAMIDE RIBOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CARBON-MONOXIDE == * common-name: ** carbon monoxide * smiles: ** [c-]#[o+] * inchi-key: ** ugfairiumavxcw-uhfffaoysa-n * molecular-weigh...") |
(Created page with "Category:metabolite == Metabolite NICOTINAMIDE_RIBOSE == * common-name: ** 1-(β-d ribofuranosyl)nicotinamide * smiles: ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2)...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite NICOTINAMIDE_RIBOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-(β-d ribofuranosyl)nicotinamide |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jlebzpbdrkpwtd-turqnecasa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 255.25 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-5841]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-(β-d ribofuranosyl)nicotinamide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jlebzpbdrkpwtd-turqnecasa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=255.25}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite NICOTINAMIDE_RIBOSE
- common-name:
- 1-(β-d ribofuranosyl)nicotinamide
- smiles:
- c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
- inchi-key:
- jlebzpbdrkpwtd-turqnecasa-o
- molecular-weight:
- 255.25
