|
|
| (9 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYLORNDEACET-RXN ACETYLORNDEACET-RXN] == | + | == Metabolite NICOTINAMIDE_RIBOSE == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** acetylornithine deacetylase | + | ** 1-(β-d ribofuranosyl)nicotinamide |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/3.5.1.16 ec-3.5.1.16] | + | ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2)) |
| − | == Reaction formula ==
| + | * inchi-key: |
| − | * 1 [[N-ALPHA-ACETYLORNITHINE]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[ACET]][c] '''+''' 1 [[L-ORNITHINE]][c]
| + | ** jlebzpbdrkpwtd-turqnecasa-o |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ21981]] | + | ** 255.25 |
| − | ** Category: [[orthology]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN-5841]] |
| − | * Gene: [[SJ09884]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[orthology]]
| + | {{#set: common-name=1-(β-d ribofuranosyl)nicotinamide}} |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: inchi-key=inchikey=jlebzpbdrkpwtd-turqnecasa-o}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: molecular-weight=255.25}} |
| − | * Gene: [[SJ01931]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ22394]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | == Pathway(s) == | |
| − | * [[GLUTORN-PWY]], L-ornithine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLUTORN-PWY GLUTORN-PWY]
| |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15944 15944]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00669 R00669]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P23908 P23908]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CI04 Q9CI04]
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=acetylornithine deacetylase}} | |
| − | {{#set: ec-number=ec-3.5.1.16}}
| |
| − | {{#set: nb gene associated=4}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=orthology|annotation}} | |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
