Difference between revisions of "NICOTINATE NUCLEOTIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ08130 == * transcription-direction: ** negative * right-end-position: ** 34296 * left-end-position: ** 26953 * centisome-position: ** 46.554165...")
(Created page with "Category:metabolite == Metabolite NICOTINATE_NUCLEOTIDE == * common-name: ** β-nicotinate d-ribonucleotide * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ08130 ==
+
== Metabolite NICOTINATE_NUCLEOTIDE ==
* transcription-direction:
+
* common-name:
** negative
+
** β-nicotinate d-ribonucleotide
* right-end-position:
+
* smiles:
** 34296
+
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
* left-end-position:
+
* inchi-key:
** 26953
+
** jouiqrnqjgxqdc-zyuzmqfosa-l
* centisome-position:
+
* molecular-weight:
** 46.554165   
+
** 333.191
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[NICONUCADENYLYLTRAN-RXN]]
== Reaction(s) associated ==
+
* [[RXN-14227]]
* [[RXN-6883]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[QUINOPRIBOTRANS-RXN]]
** Category: [[orthology]]
+
* [[RXN-8443]]
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) associated ==
+
{{#set: common-name=β-nicotinate d-ribonucleotide}}
* [[PWY-4302]]
+
{{#set: inchi-key=inchikey=jouiqrnqjgxqdc-zyuzmqfosa-l}}
** '''3''' reactions found over '''3''' reactions in the full pathway
+
{{#set: molecular-weight=333.191}}
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=34296}}
 
{{#set: left-end-position=26953}}
 
{{#set: centisome-position=46.554165    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite NICOTINATE_NUCLEOTIDE

  • common-name:
    • β-nicotinate d-ribonucleotide
  • smiles:
    • c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
  • inchi-key:
    • jouiqrnqjgxqdc-zyuzmqfosa-l
  • molecular-weight:
    • 333.191

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality