Difference between revisions of "NICOTINATE NUCLEOTIDE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ17550 == * transcription-direction: ** negative * right-end-position: ** 119912 * left-end-position: ** 109789 * centisome-position: ** 42.227512...") |
(Created page with "Category:metabolite == Metabolite NICOTINATE_NUCLEOTIDE == * common-name: ** β-nicotinate d-ribonucleotide * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite NICOTINATE_NUCLEOTIDE == |
− | * | + | * common-name: |
− | ** | + | ** β-nicotinate d-ribonucleotide |
− | * | + | * smiles: |
− | ** | + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2)) |
− | * | + | * inchi-key: |
− | ** | + | ** jouiqrnqjgxqdc-zyuzmqfosa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 333.191 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[NICONUCADENYLYLTRAN-RXN]] |
− | == Reaction(s) | + | * [[RXN-14227]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[NICOTINATEPRIBOSYLTRANS-RXN]] |
− | + | * [[QUINOPRIBOTRANS-RXN]] | |
− | + | * [[RXN-8443]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=β-nicotinate d-ribonucleotide}} | |
− | + | {{#set: inchi-key=inchikey=jouiqrnqjgxqdc-zyuzmqfosa-l}} | |
− | + | {{#set: molecular-weight=333.191}} | |
− | |||
− | == | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite NICOTINATE_NUCLEOTIDE
- common-name:
- β-nicotinate d-ribonucleotide
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
- inchi-key:
- jouiqrnqjgxqdc-zyuzmqfosa-l
- molecular-weight:
- 333.191