Difference between revisions of "NICOTINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE == * common-name: ** 2-c-methyl-d-erythritol 4-phosphate * smiles: ** cc(o)(co)c(o)cop([o-])([o-])=o...")
(Created page with "Category:metabolite == Metabolite NICOTINE == * common-name: ** (s)-nicotine * smiles: ** c1(cc[ch]([n+](c)1)c2(c=nc=cc=2)) * inchi-key: ** snicxcgakadscv-jtqlqieisa-o * m...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE ==
+
== Metabolite NICOTINE ==
 
* common-name:
 
* common-name:
** 2-c-methyl-d-erythritol 4-phosphate
+
** (s)-nicotine
 
* smiles:
 
* smiles:
** cc(o)(co)c(o)cop([o-])([o-])=o
+
** c1(cc[ch]([n+](c)1)c2(c=nc=cc=2))
 
* inchi-key:
 
* inchi-key:
** xmwhrvnvkdkbrg-uhnvwzdzsa-l
+
** snicxcgakadscv-jtqlqieisa-o
 
* molecular-weight:
 
* molecular-weight:
** 214.111
+
** 163.242
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.60-RXN]]
+
* [[RXN66-146]]
* [[DXPREDISOM-RXN]]
+
* [[RXN66-81]]
 +
* [[RXN66-83]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DXPREDISOM-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-c-methyl-d-erythritol 4-phosphate}}
+
{{#set: common-name=(s)-nicotine}}
{{#set: inchi-key=inchikey=xmwhrvnvkdkbrg-uhnvwzdzsa-l}}
+
{{#set: inchi-key=inchikey=snicxcgakadscv-jtqlqieisa-o}}
{{#set: molecular-weight=214.111}}
+
{{#set: molecular-weight=163.242}}

Latest revision as of 11:12, 18 March 2021

Metabolite NICOTINE

  • common-name:
    • (s)-nicotine
  • smiles:
    • c1(cc[ch]([n+](c)1)c2(c=nc=cc=2))
  • inchi-key:
    • snicxcgakadscv-jtqlqieisa-o
  • molecular-weight:
    • 163.242

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality