Difference between revisions of "NITRATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CAMP == * common-name: ** cyclic-amp * smiles: ** c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34)) * inchi-key: ** ivomouwhdpkr...") |
(Created page with "Category:metabolite == Metabolite NITRATE == * common-name: ** nitrate * smiles: ** n(=o)(=o)[o-] * inchi-key: ** nhnbfggvmkefgy-uhfffaoysa-n * molecular-weight: ** 62.005...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite NITRATE == |
* common-name: | * common-name: | ||
− | ** | + | ** nitrate |
* smiles: | * smiles: | ||
− | ** | + | ** n(=o)(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** nhnbfggvmkefgy-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 62.005 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ExchangeSeed-NITRATE]] |
+ | * [[NITRATE-REDUCTASE-NADH-RXN]] | ||
+ | * [[NITRATE-REDUCTASE-NADPH-RXN]] | ||
+ | * [[NITRATE-REDUCTASE-NADPORNOPH-RXN]] | ||
+ | * [[NITRATREDUCT-RXN]] | ||
+ | * [[NO3t]] | ||
+ | * [[TCV3]] | ||
+ | * [[TransportSeed-NITRATE]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ExchangeSeed-NITRATE]] |
+ | * [[NITRATREDUCT-RXN]] | ||
+ | * [[NO3t]] | ||
+ | * [[NODOx]] | ||
+ | * [[NODOy]] | ||
+ | * [[R621-RXN]] | ||
+ | * [[TCV3]] | ||
+ | * [[TransportSeed-NITRATE]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=nitrate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nhnbfggvmkefgy-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=62.005}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite NITRATE
- common-name:
- nitrate
- smiles:
- n(=o)(=o)[o-]
- inchi-key:
- nhnbfggvmkefgy-uhfffaoysa-n
- molecular-weight:
- 62.005
Reaction(s) known to consume the compound
- ExchangeSeed-NITRATE
- NITRATE-REDUCTASE-NADH-RXN
- NITRATE-REDUCTASE-NADPH-RXN
- NITRATE-REDUCTASE-NADPORNOPH-RXN
- NITRATREDUCT-RXN
- NO3t
- TCV3
- TransportSeed-NITRATE