Difference between revisions of "NITRIC-OXIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE == * common-name: ** 3,4-dihydroxyphenylglycolaldehyde * smiles: ** c(=o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite 5-carbo-me-ami-me-ur-34-tRNALeu == * common-name: ** a 5-carboxymethylaminomethyluridine34 in trnaleu == Reaction(s) known to consume the...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-carbo-me-ami-me-ur-34-tRNALeu == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 5-carboxymethylaminomethyluridine34 in trnaleu |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11865]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 5-carboxymethylaminomethyluridine34 in trnaleu}} |
| − | |||
| − | |||
Revision as of 18:57, 14 January 2021
Contents
Metabolite 5-carbo-me-ami-me-ur-34-tRNALeu
- common-name:
- a 5-carboxymethylaminomethyluridine34 in trnaleu
