Difference between revisions of "NITRITE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite XANTHOSINE-5-PHOSPHATE == * common-name: ** xmp * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite BENZOATE == * common-name: ** benzoate * smiles: ** c(c1(c=cc=cc=1))([o-])=o * inchi-key: ** wpymklbdigxbtp-uhfffaoysa-m * molecular-weig...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite BENZOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** benzoate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(c1(c=cc=cc=1))([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wpymklbdigxbtp-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 121.115 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=benzoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wpymklbdigxbtp-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=121.115}} |
Revision as of 18:59, 14 January 2021
Contents
Metabolite BENZOATE
- common-name:
- benzoate
- smiles:
- c(c1(c=cc=cc=1))([o-])=o
- inchi-key:
- wpymklbdigxbtp-uhfffaoysa-m
- molecular-weight:
- 121.115
