Difference between revisions of "NITRITE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-TOLUENECARBOXYLATE == * common-name: ** 4-toluenecarboxylate * smiles: ** cc1(c=cc(=cc=1)c(=o)[o-]) * inchi-key: ** lpnbbfkouusudb-uhff...")
(Created page with "Category:metabolite == Metabolite NITRITE == * common-name: ** nitrite * smiles: ** n([o-])=o * inchi-key: ** iovcwxunbopuch-uhfffaoysa-m * molecular-weight: ** 46.005 ==...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-TOLUENECARBOXYLATE ==
+
== Metabolite NITRITE ==
 
* common-name:
 
* common-name:
** 4-toluenecarboxylate
+
** nitrite
 
* smiles:
 
* smiles:
** cc1(c=cc(=cc=1)c(=o)[o-])
+
** n([o-])=o
 
* inchi-key:
 
* inchi-key:
** lpnbbfkouusudb-uhfffaoysa-m
+
** iovcwxunbopuch-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 135.142
+
** 46.005
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[FERREDOXIN--NITRITE-REDUCTASE-RXN]]
 +
* [[NITRATREDUCT-RXN]]
 +
* [[NITRITE-REDUCTASE-CYTOCHROME-RXN]]
 +
* [[RXN-15838]]
 +
* [[RXN0-6377]]
 +
* [[TRANS-RXN-137]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8582]]
+
* [[2-NITROPROPANE-DIOXYGENASE-RXN]]
 +
* [[NITRATE-REDUCTASE-NADH-RXN]]
 +
* [[NITRATE-REDUCTASE-NADPH-RXN]]
 +
* [[NITRATE-REDUCTASE-NADPORNOPH-RXN]]
 +
* [[NITRATREDUCT-RXN]]
 +
* [[RXN-15838]]
 +
* [[RXN-16322]]
 +
* [[RXN-3661]]
 +
* [[TRANS-RXN-137]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-toluenecarboxylate}}
+
{{#set: common-name=nitrite}}
{{#set: inchi-key=inchikey=lpnbbfkouusudb-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=iovcwxunbopuch-uhfffaoysa-m}}
{{#set: molecular-weight=135.142}}
+
{{#set: molecular-weight=46.005}}

Latest revision as of 11:17, 18 March 2021