Difference between revisions of "NMNH"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15653 == * common-name: ** (3r)-hydroxy, 6-cis-tridecenoyl-coa * smiles: ** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...") |
(Created page with "Category:metabolite == Metabolite NMNH == * common-name: ** reduced β-nicotinamide d-ribonucleotide * smiles: ** c1(=c(cc=cn1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))c(n)=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite NMNH == |
* common-name: | * common-name: | ||
| − | ** | + | ** reduced β-nicotinamide d-ribonucleotide |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(=c(cc=cn1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))c(n)=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xqhmusrslnrvga-turqnecasa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 334.222 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-4401]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=reduced β-nicotinamide d-ribonucleotide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xqhmusrslnrvga-turqnecasa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=334.222}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite NMNH
- common-name:
- reduced β-nicotinamide d-ribonucleotide
- smiles:
- c1(=c(cc=cn1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))c(n)=o)
- inchi-key:
- xqhmusrslnrvga-turqnecasa-l
- molecular-weight:
- 334.222
