Difference between revisions of "NMNH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2500 == * common-name: ** p-nitrophenyl-α-d-galactopyranoside * smiles: ** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o...")
(Created page with "Category:metabolite == Metabolite HOMO-CIT == * common-name: ** (2r)-homocitrate * smiles: ** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o * inchi-key: ** xkjvevrqmlksmo-ssdotts...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2500 ==
+
== Metabolite HOMO-CIT ==
 
* common-name:
 
* common-name:
** p-nitrophenyl-α-d-galactopyranoside
+
** (2r)-homocitrate
 
* smiles:
 
* smiles:
** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o2)
+
** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o
 
* inchi-key:
 
* inchi-key:
** ifbhrqdfsncloz-iirvcbmxsa-n
+
** xkjvevrqmlksmo-ssdottswsa-k
 
* molecular-weight:
 
* molecular-weight:
** 301.252
+
** 203.128
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17830]]
+
* [[RXN-13722]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13722]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=p-nitrophenyl-α-d-galactopyranoside}}
+
{{#set: common-name=(2r)-homocitrate}}
{{#set: inchi-key=inchikey=ifbhrqdfsncloz-iirvcbmxsa-n}}
+
{{#set: inchi-key=inchikey=xkjvevrqmlksmo-ssdottswsa-k}}
{{#set: molecular-weight=301.252}}
+
{{#set: molecular-weight=203.128}}

Revision as of 14:58, 5 January 2021

Metabolite HOMO-CIT

  • common-name:
    • (2r)-homocitrate
  • smiles:
    • c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o
  • inchi-key:
    • xkjvevrqmlksmo-ssdottswsa-k
  • molecular-weight:
    • 203.128

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality