Difference between revisions of "NMNH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LANOSTEROL-SYNTHASE-RXN LANOSTEROL-SYNTHASE-RXN] == * direction: ** left-to-right * common-name: **...")
(Created page with "Category:metabolite == Metabolite CPD0-2500 == * common-name: ** p-nitrophenyl-α-d-galactopyranoside * smiles: ** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=LANOSTEROL-SYNTHASE-RXN LANOSTEROL-SYNTHASE-RXN] ==
+
== Metabolite CPD0-2500 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** lanosterol synthase
+
** p-nitrophenyl-α-d-galactopyranoside
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/5.4.99.7 ec-5.4.99.7]
+
** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o2)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[EPOXYSQUALENE]][c] '''=>''' 1 [[LANOSTEROL]][c]
+
** ifbhrqdfsncloz-iirvcbmxsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09945]]
+
** 301.252
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-17830]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-6132]], lanosterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6132 PWY-6132]
+
== Reaction(s) of unknown directionality ==
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
{{#set: common-name=p-nitrophenyl-α-d-galactopyranoside}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=ifbhrqdfsncloz-iirvcbmxsa-n}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=301.252}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14622 14622]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R03199 R03199]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/P48449 P48449]
 
−
** [http://www.uniprot.org/uniprot/Q10231 Q10231]
 
−
** [http://www.uniprot.org/uniprot/Q04782 Q04782]
 
−
** [http://www.uniprot.org/uniprot/P38604 P38604]
 
−
** [http://www.uniprot.org/uniprot/Q59080 Q59080]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=lanosterol synthase}}
 
−
{{#set: ec-number=ec-5.4.99.7}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD0-2500

  • common-name:
    • p-nitrophenyl-α-d-galactopyranoside
  • smiles:
    • c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o2)
  • inchi-key:
    • ifbhrqdfsncloz-iirvcbmxsa-n
  • molecular-weight:
    • 301.252

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=NMNH&oldid=47589"