Difference between revisions of "NN-DIMETHYLANILINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-193 == * common-name: ** d-myo-inositol (4,5)-bisphosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1) *...") |
(Created page with "Category:metabolite == Metabolite NN-DIMETHYLANILINE == * common-name: ** n,n-dimethylaniline * smiles: ** cn(c1(c=cc=cc=1))c * inchi-key: ** jltdjthdqawbav-uhfffaoysa-n *...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite NN-DIMETHYLANILINE == |
* common-name: | * common-name: | ||
− | ** | + | ** n,n-dimethylaniline |
* smiles: | * smiles: | ||
− | ** c1 | + | ** cn(c1(c=cc=cc=1))c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** jltdjthdqawbav-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 121.182 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[1.14.13.8-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n,n-dimethylaniline}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jltdjthdqawbav-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=121.182}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite NN-DIMETHYLANILINE
- common-name:
- n,n-dimethylaniline
- smiles:
- cn(c1(c=cc=cc=1))c
- inchi-key:
- jltdjthdqawbav-uhfffaoysa-n
- molecular-weight:
- 121.182