Difference between revisions of "NN-DIMETHYLANILINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-193 == * common-name: ** d-myo-inositol (4,5)-bisphosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1) *...") |
(Created page with "Category:metabolite == Metabolite 3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN == * common-name: ** phlorisovalerophenone * smiles: ** cc(cc(c1(c(=cc(=cc=1o)o)o))=o)c * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN == |
* common-name: | * common-name: | ||
| − | ** | + | ** phlorisovalerophenone |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(cc(c1(c(=cc(=cc=1o)o)o))=o)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vsdwhzgjgwmirn-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 210.229 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7811]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phlorisovalerophenone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vsdwhzgjgwmirn-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=210.229}} |
Revision as of 15:24, 5 January 2021
Contents
Metabolite 3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN
- common-name:
- phlorisovalerophenone
- smiles:
- cc(cc(c1(c(=cc(=cc=1o)o)o))=o)c
- inchi-key:
- vsdwhzgjgwmirn-uhfffaoysa-n
- molecular-weight:
- 210.229
