Difference between revisions of "NN-dimethyl-terminal-PPK"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-693 == * common-name: ** 2-cis-abscisate * smiles: ** cc(=cc([o-])=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o * inchi-key: ** jlidbldqvayhne-ykal...") |
(Created page with "Category:metabolite == Metabolite Cysteine-Desulfurase-L-cysteine == * common-name: ** an [l-cysteine desulfurase]-l-cysteine == Reaction(s) known to consume the compound...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Cysteine-Desulfurase-L-cysteine == |
* common-name: | * common-name: | ||
| − | ** | + | ** an [l-cysteine desulfurase]-l-cysteine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12587]] | ||
| + | * [[RXN0-308]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12473]] |
| + | * [[RXN-12587]] | ||
| + | * [[RXN-14382]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an [l-cysteine desulfurase]-l-cysteine}} |
| − | |||
| − | |||
Revision as of 11:14, 15 January 2021
Contents
Metabolite Cysteine-Desulfurase-L-cysteine
- common-name:
- an [l-cysteine desulfurase]-l-cysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an [l-cysteine desulfurase]-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
