Difference between revisions of "NN-dimethyl-terminal-PPK"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-693 == * common-name: ** 2-cis-abscisate * smiles: ** cc(=cc([o-])=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o * inchi-key: ** jlidbldqvayhne-ykal...") |
(Created page with "Category:metabolite == Metabolite NN-dimethyl-terminal-PPK == * common-name: ** an n terminal n,n-dimethyl-ppk-[protein] == Reaction(s) known to consume the compound == ==...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite NN-dimethyl-terminal-PPK == |
* common-name: | * common-name: | ||
− | ** | + | ** an n terminal n,n-dimethyl-ppk-[protein] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13226]] |
+ | * [[RXN-13228]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an n terminal n,n-dimethyl-ppk-[protein]}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite NN-dimethyl-terminal-PPK
- common-name:
- an n terminal n,n-dimethyl-ppk-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n terminal n,n-dimethyl-ppk-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.