Difference between revisions of "NN-dimethyl-terminal-PPK"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-methionyl-L-valyl-Protein == * common-name: ** an n-terminal-l-methionyl-l-valyl-[protein] == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite CPD-12706 == * common-name: ** 5-fluoro-5-deoxy-d-ribose 1-phosphate * smiles: ** c(c1(oc(op([o-])(=o)[o-])c(o)c1o))f * inchi-key: ** luq...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12706 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-fluoro-5-deoxy-d-ribose 1-phosphate |
| + | * smiles: | ||
| + | ** c(c1(oc(op([o-])(=o)[o-])c(o)c1o))f | ||
| + | * inchi-key: | ||
| + | ** luqfmenctwebsq-txicztdvsa-l | ||
| + | * molecular-weight: | ||
| + | ** 230.086 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11743]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-fluoro-5-deoxy-d-ribose 1-phosphate}} |
| + | {{#set: inchi-key=inchikey=luqfmenctwebsq-txicztdvsa-l}} | ||
| + | {{#set: molecular-weight=230.086}} | ||
Revision as of 15:26, 5 January 2021
Contents
Metabolite CPD-12706
- common-name:
- 5-fluoro-5-deoxy-d-ribose 1-phosphate
- smiles:
- c(c1(oc(op([o-])(=o)[o-])c(o)c1o))f
- inchi-key:
- luqfmenctwebsq-txicztdvsa-l
- molecular-weight:
- 230.086
