Difference between revisions of "NONMEVIPP-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLLATE GLYCOLLATE] == * common-name: ** glycolate * smiles: ** c(c(=o)[o-])o * inchi-key: *...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] == * common-name: ** 3-oxo-(9z)-octadecenoyl-coa * smiles: ** ccccccccc=cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLLATE GLYCOLLATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] ==
 
* common-name:
 
* common-name:
** glycolate
+
** 3-oxo-(9z)-octadecenoyl-coa
 
* smiles:
 
* smiles:
** c(c(=o)[o-])o
+
** ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** aemrfaofkbgasw-uhfffaoysa-m
+
** aveyykdekgjvbu-bpmmelmssa-j
 
* molecular-weight:
 
* molecular-weight:
** 75.044
+
** 1041.936
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLYCOLATEDEHYDRO-RXN]]
+
* [[RXN-17778]]
* [[HDAO10x]]
 
* [[RXN-969]]
 
* [[RXN0-7229]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLYOXYLATE-REDUCTASE-NADP+-RXN]]
+
* [[RXN-17777]]
* [[GPH-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glycolate}}
+
{{#set: common-name=3-oxo-(9z)-octadecenoyl-coa}}
{{#set: inchi-key=inchikey=aemrfaofkbgasw-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=aveyykdekgjvbu-bpmmelmssa-j}}
{{#set: molecular-weight=75.044}}
+
{{#set: molecular-weight=1041.936}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-19169

  • common-name:
    • 3-oxo-(9z)-octadecenoyl-coa
  • smiles:
    • ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • aveyykdekgjvbu-bpmmelmssa-j
  • molecular-weight:
    • 1041.936

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality