Difference between revisions of "NONOXIPENT-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17331 CPD-17331] == * common-name: ** (9z,12z,15z,18z,21z)-tetracosapentaenoyl-coa * smiles...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G-protein-coupled-receptors G-protein-coupled-receptors] == * common-name: ** a g protein-coupl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17331 CPD-17331] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G-protein-coupled-receptors G-protein-coupled-receptors] ==
 
* common-name:
 
* common-name:
** (9z,12z,15z,18z,21z)-tetracosapentaenoyl-coa
+
** a g protein-coupled receptor
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** bnamtmvbovnnsh-afqbpcmksa-j
 
* molecular-weight:
 
** 1104.05
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16132]]
+
* [[2.7.11.16-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.7.11.16-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(9z,12z,15z,18z,21z)-tetracosapentaenoyl-coa}}
+
{{#set: common-name=a g protein-coupled receptor}}
{{#set: inchi-key=inchikey=bnamtmvbovnnsh-afqbpcmksa-j}}
 
{{#set: molecular-weight=1104.05}}
 

Revision as of 14:19, 26 August 2019

Metabolite G-protein-coupled-receptors

  • common-name:
    • a g protein-coupled receptor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality