Difference between revisions of "NOREPINEPHRINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-OXO-EICOSAPENTAENOYL-ACP == * common-name: ** a 3-oxo-docosapentaenoyl [acp] == Reaction(s) known to consume the compound == * RXN-13...") |
(Created page with "Category:metabolite == Metabolite NOREPINEPHRINE == * common-name: ** (r)-noradrenaline * smiles: ** c1(c=c(o)c(=cc=1c(c[n+])o)o) * inchi-key: ** sflshlfxelfnjz-qmmmgpobsa...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite NOREPINEPHRINE == |
* common-name: | * common-name: | ||
− | ** | + | ** (r)-noradrenaline |
+ | * smiles: | ||
+ | ** c1(c=c(o)c(=cc=1c(c[n+])o)o) | ||
+ | * inchi-key: | ||
+ | ** sflshlfxelfnjz-qmmmgpobsa-o | ||
+ | * molecular-weight: | ||
+ | ** 170.188 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-10907]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(r)-noradrenaline}} |
+ | {{#set: inchi-key=inchikey=sflshlfxelfnjz-qmmmgpobsa-o}} | ||
+ | {{#set: molecular-weight=170.188}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite NOREPINEPHRINE
- common-name:
- (r)-noradrenaline
- smiles:
- c1(c=c(o)c(=cc=1c(c[n+])o)o)
- inchi-key:
- sflshlfxelfnjz-qmmmgpobsa-o
- molecular-weight:
- 170.188