Difference between revisions of "NOREPINEPHRINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SPHINGOSINE-N-ACYLTRANSFERASE-RXN SPHINGOSINE-N-ACYLTRANSFERASE-RXN] == * direction: ** reversible...")
 
(Created page with "Category:metabolite == Metabolite NOREPINEPHRINE == * common-name: ** (r)-noradrenaline * smiles: ** c1(c=c(o)c(=cc=1c(c[n+])o)o) * inchi-key: ** sflshlfxelfnjz-qmmmgpobsa...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SPHINGOSINE-N-ACYLTRANSFERASE-RXN SPHINGOSINE-N-ACYLTRANSFERASE-RXN] ==
+
== Metabolite NOREPINEPHRINE ==
−
* direction:
+
* common-name:
−
** reversible
+
** (r)-noradrenaline
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.1.24 ec-2.3.1.24]
+
** c1(c=c(o)c(=cc=1c(c[n+])o)o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ACYL-COA]][c] '''+''' 1 [[Sphingoids]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[Ceramides]][c] '''+''' 1 [[PROTON]][c]
+
** sflshlfxelfnjz-qmmmgpobsa-o
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ06297]]
+
** 170.188
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-10907]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=(r)-noradrenaline}}
−
* RHEA:
+
{{#set: inchi-key=inchikey=sflshlfxelfnjz-qmmmgpobsa-o}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23768 23768]
+
{{#set: molecular-weight=170.188}}
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R01496 R01496]
 
−
{{#set: direction=reversible}}
 
−
{{#set: ec-number=ec-2.3.1.24}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite NOREPINEPHRINE

  • common-name:
    • (r)-noradrenaline
  • smiles:
    • c1(c=c(o)c(=cc=1c(c[n+])o)o)
  • inchi-key:
    • sflshlfxelfnjz-qmmmgpobsa-o
  • molecular-weight:
    • 170.188

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=NOREPINEPHRINE&oldid=139006"