Difference between revisions of "Negatively-super-coiled-DNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HYDROXYMETHYLBILANE == * common-name: ** preuroporphyrinogen * smiles: ** c(o)c1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(cc(=o)[o-])c(cc...")
(Created page with "Category:metabolite == Metabolite Negatively-super-coiled-DNAs == * common-name: ** a negatively supercoiled dna == Reaction(s) known to consume the compound == * 5.99.1...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HYDROXYMETHYLBILANE ==
+
== Metabolite Negatively-super-coiled-DNAs ==
 
* common-name:
 
* common-name:
** preuroporphyrinogen
+
** a negatively supercoiled dna
* smiles:
 
** c(o)c1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(cc(=o)[o-])c(ccc(=o)[o-])=c(n2)cc4(=c(cc([o-])=o)c(ccc(=o)[o-])=c(cc3(=c(cc([o-])=o)c(ccc(=o)[o-])=cn3))n4)))
 
* inchi-key:
 
** wdfjyrzcziubpr-uhfffaoysa-f
 
* molecular-weight:
 
** 846.757
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[UROGENIIISYN-RXN]]
+
* [[5.99.1.2-RXN]]
 +
* [[5.99.1.3-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[OHMETHYLBILANESYN-RXN]]
+
* [[5.99.1.2-RXN]]
 +
* [[5.99.1.3-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=preuroporphyrinogen}}
+
{{#set: common-name=a negatively supercoiled dna}}
{{#set: inchi-key=inchikey=wdfjyrzcziubpr-uhfffaoysa-f}}
 
{{#set: molecular-weight=846.757}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Negatively-super-coiled-DNAs

  • common-name:
    • a negatively supercoiled dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality