Difference between revisions of "Negatively-super-coiled-DNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TREHALOSE == * common-name: ** α,α-trehalose * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o * inchi-key: ** hdt...") |
(Created page with "Category:metabolite == Metabolite Negatively-super-coiled-DNAs == * common-name: ** a negatively supercoiled dna == Reaction(s) known to consume the compound == * 5.99.1...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Negatively-super-coiled-DNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a negatively supercoiled dna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[5.99.1.2-RXN]] |
| + | * [[5.99.1.3-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[5.99.1.2-RXN]] |
| + | * [[5.99.1.3-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a negatively supercoiled dna}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Negatively-super-coiled-DNAs
- common-name:
- a negatively supercoiled dna
