Difference between revisions of "Non-Fucosylated-Fucose-Acceptors"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD66-34 == * common-name: ** 1,2-dipalmitoylglycerol * smiles: ** cccccccccccccccc(occ(oc(=o)ccccccccccccccc)co)=o * inchi-key: ** jejlg...") |
(Created page with "Category:metabolite == Metabolite 7-8-DIHYDROPTEROATE == * common-name: ** 7,8-dihydropteroate * smiles: ** c(nc1(=cc=c(c(=o)[o-])c=c1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3)) * in...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 7-8-DIHYDROPTEROATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7,8-dihydropteroate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(nc1(=cc=c(c(=o)[o-])c=c1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wbfyvdchgvnrbh-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 313.295 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DIHYDROFOLATESYNTH-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[H2PTEROATESYNTH-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7,8-dihydropteroate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wbfyvdchgvnrbh-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=313.295}} |
Revision as of 08:26, 15 March 2021
Contents
Metabolite 7-8-DIHYDROPTEROATE
- common-name:
- 7,8-dihydropteroate
- smiles:
- c(nc1(=cc=c(c(=o)[o-])c=c1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3))
- inchi-key:
- wbfyvdchgvnrbh-uhfffaoysa-m
- molecular-weight:
- 313.295
