Difference between revisions of "Non-Fucosylated-Fucose-Acceptors"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13395 == * common-name: ** glycyl-l-asparagine * smiles: ** c([n+])c(=o)nc(cc(n)=o)c([o-])=o * inchi-key: ** fuesbomyallfni-vkhmyheas...") |
(Created page with "Category:metabolite == Metabolite Non-Fucosylated-Fucose-Acceptors == * common-name: ** a non fucosylated fucose acceptor == Reaction(s) known to consume the compound == =...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Non-Fucosylated-Fucose-Acceptors == |
* common-name: | * common-name: | ||
| − | ** | + | ** a non fucosylated fucose acceptor |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.2.1.38-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a non fucosylated fucose acceptor}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Non-Fucosylated-Fucose-Acceptors
- common-name:
- a non fucosylated fucose acceptor
