Difference between revisions of "Non-Glucur-Glucuronoside-Acceptors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9100 == * common-name: ** tetrahydrogeranylgeranyl bacteriopheophytin * smiles: ** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(...")
(Created page with "Category:metabolite == Metabolite Non-Glucur-Glucuronoside-Acceptors == * common-name: ** a non-glucuronated glucosyluronate acceptor == Reaction(s) known to consume the c...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9100 ==
+
== Metabolite Non-Glucur-Glucuronoside-Acceptors ==
 
* common-name:
 
* common-name:
** tetrahydrogeranylgeranyl bacteriopheophytin
+
** a non-glucuronated glucosyluronate acceptor
* smiles:
 
** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cccc(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
 
* inchi-key:
 
** zodfiocmoawrmb-zasykxldsa-n
 
* molecular-weight:
 
** 886.205
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8796]]
+
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8795]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tetrahydrogeranylgeranyl bacteriopheophytin}}
+
{{#set: common-name=a non-glucuronated glucosyluronate acceptor}}
{{#set: inchi-key=inchikey=zodfiocmoawrmb-zasykxldsa-n}}
 
{{#set: molecular-weight=886.205}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Non-Glucur-Glucuronoside-Acceptors

  • common-name:
    • a non-glucuronated glucosyluronate acceptor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality