Difference between revisions of "Non-Glucur-Glucuronoside-Acceptors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10958 == * transcription-direction: ** negative * right-end-position: ** 9322 * left-end-position: ** 8330 * centisome-position: ** 0.5766785 =...")
(Created page with "Category:metabolite == Metabolite CPD-9100 == * common-name: ** tetrahydrogeranylgeranyl bacteriopheophytin * smiles: ** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ10958 ==
+
== Metabolite CPD-9100 ==
* transcription-direction:
+
* common-name:
** negative
+
** tetrahydrogeranylgeranyl bacteriopheophytin
* right-end-position:
+
* smiles:
** 9322
+
** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cccc(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
* left-end-position:
+
* inchi-key:
** 8330
+
** zodfiocmoawrmb-zasykxldsa-n
* centisome-position:
+
* molecular-weight:
** 0.5766785   
+
** 886.205
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-8796]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
* [[RXN-8795]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=tetrahydrogeranylgeranyl bacteriopheophytin}}
{{#set: transcription-direction=negative}}
+
{{#set: inchi-key=inchikey=zodfiocmoawrmb-zasykxldsa-n}}
{{#set: right-end-position=9322}}
+
{{#set: molecular-weight=886.205}}
{{#set: left-end-position=8330}}
 
{{#set: centisome-position=0.5766785    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-9100

  • common-name:
    • tetrahydrogeranylgeranyl bacteriopheophytin
  • smiles:
    • ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cccc(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
  • inchi-key:
    • zodfiocmoawrmb-zasykxldsa-n
  • molecular-weight:
    • 886.205

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality