Difference between revisions of "Nonmethylated-Ribosomal-Protein-L11s"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-DEHYDRO-SHIKIMATE == * common-name: ** 3-dehydroshikimate * smiles: ** c([o-])(=o)c1(=cc(=o)c(o)c(o)c1) * inchi-key: ** slwwjzmphjjoph-...")
(Created page with "Category:metabolite == Metabolite GLY == * common-name: ** glycine * smiles: ** c([n+])c([o-])=o * inchi-key: ** dhmqdgoqfoqnfh-uhfffaoysa-n * molecular-weight: ** 75.067...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite 3-DEHYDRO-SHIKIMATE ==
+
== Metabolite GLY ==
 
* common-name:
 
* common-name:
−
** 3-dehydroshikimate
+
** glycine
 
* smiles:
 
* smiles:
−
** c([o-])(=o)c1(=cc(=o)c(o)c(o)c1)
+
** c([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
−
** slwwjzmphjjoph-phdidxhhsa-m
+
** dhmqdgoqfoqnfh-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 171.129
+
** 75.067
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
+
* [[1.4.3.19-RXN]]
−
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
+
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
 +
* [[GCVP-RXN]]
 +
* [[GLUTATHIONE-SYN-RXN]]
 +
* [[GLYCINE--TRNA-LIGASE-RXN]]
 +
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 +
* [[GLYCINE-N-METHYLTRANSFERASE-RXN]]
 +
* [[GLYOHMETRANS-RXN]]
 +
* [[GLYRIBONUCSYN-RXN]]
 +
* [[RXN-10821]]
 +
* [[RXN-12614]]
 +
* [[RXN-13404]]
 +
* [[RXN-13406]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* [[RXN-7968]]
+
* [[2.3.2.15-RXN]]
 +
* [[AKBLIG-RXN]]
 +
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
 +
* [[GCVP-RXN]]
 +
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 +
* [[GLYOHMETRANS-RXN]]
 +
* [[LTAA-RXN]]
 +
* [[RXN-13677]]
 +
* [[RXN-6622]]
 +
* [[RXN-6642]]
 +
* [[RXN-9896]]
 +
* [[RXN0-5234]]
 +
* [[RXN0-6974]]
 +
* [[RXN0-6977]]
 +
* [[RXN0-6982]]
 +
* [[RXN0-6983]]
 +
* [[RXN0-6984]]
 +
* [[RXN0-6987]]
 +
* [[RXN0-6988]]
 +
* [[THREONINE-ALDOLASE-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-dehydroshikimate}}
+
{{#set: common-name=glycine}}
−
{{#set: inchi-key=inchikey=slwwjzmphjjoph-phdidxhhsa-m}}
+
{{#set: inchi-key=inchikey=dhmqdgoqfoqnfh-uhfffaoysa-n}}
−
{{#set: molecular-weight=171.129}}
+
{{#set: molecular-weight=75.067}}

Revision as of 08:28, 15 March 2021

Metabolite GLY

  • common-name:
    • glycine
  • smiles:
    • c([n+])c([o-])=o
  • inchi-key:
    • dhmqdgoqfoqnfh-uhfffaoysa-n
  • molecular-weight:
    • 75.067

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Nonmethylated-Ribosomal-Protein-L11s&oldid=125278"