Difference between revisions of "Nonmethylated-Ribosomal-Protein-L11s"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-DEHYDRO-SHIKIMATE == * common-name: ** 3-dehydroshikimate * smiles: ** c([o-])(=o)c1(=cc(=o)c(o)c(o)c1) * inchi-key: ** slwwjzmphjjoph-...") |
(Created page with "Category:metabolite == Metabolite Nonmethylated-Ribosomal-Protein-L11s == * common-name: ** a non-methylated ribosomal protein l11 == Reaction(s) known to consume the comp...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Nonmethylated-Ribosomal-Protein-L11s == |
* common-name: | * common-name: | ||
| − | ** | + | ** a non-methylated ribosomal protein l11 |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-5419]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a non-methylated ribosomal protein l11}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite Nonmethylated-Ribosomal-Protein-L11s
- common-name:
- a non-methylated ribosomal protein l11
