Difference between revisions of "Nonmethylated-Ribosomal-Protein-L11s"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4618 == * common-name: ** cis-zeatin-7-n-glucoside * smiles: ** cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite Nonmethylated-Ribosomal-Protein-L11s == * common-name: ** a non-methylated ribosomal protein l11 == Reaction(s) known to consume the comp...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Nonmethylated-Ribosomal-Protein-L11s == |
* common-name: | * common-name: | ||
| − | ** | + | ** a non-methylated ribosomal protein l11 |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN0-5419]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a non-methylated ribosomal protein l11}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite Nonmethylated-Ribosomal-Protein-L11s
- common-name:
- a non-methylated ribosomal protein l11
