Difference between revisions of "Nonmethylated-Ribosomal-Protein-L11s"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXY-D-RIBOSE-1-PHOSPHATE == * common-name: ** 2-deoxy-α-d-ribose 1-phosphate * smiles: ** c1(c(o)c(co)oc1op(=o)([o-])[o-]) * inch...") |
(Created page with "Category:metabolite == Metabolite HISTIDINOL == * common-name: ** histidinol * smiles: ** c1(nc=nc=1cc(co)[n+]) * inchi-key: ** zqisrdcjnbuvmm-yfkpbyrvsa-o * molecular-wei...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HISTIDINOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** histidinol |
* smiles: | * smiles: | ||
| − | ** c1( | + | ** c1(nc=nc=1cc(co)[n+]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zqisrdcjnbuvmm-yfkpbyrvsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 142.18 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[HISTOLDEHYD-RXN]] |
| − | + | * [[RXN-8001]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[HISTIDPHOS-RXN]] |
| − | * [[ | + | * [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]] |
| − | + | * [[HISTOLDEHYD-RXN]] | |
| − | |||
| − | |||
| − | * [[ | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=histidinol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zqisrdcjnbuvmm-yfkpbyrvsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=142.18}} |
Revision as of 13:10, 14 January 2021
Contents
Metabolite HISTIDINOL
- common-name:
- histidinol
- smiles:
- c1(nc=nc=1cc(co)[n+])
- inchi-key:
- zqisrdcjnbuvmm-yfkpbyrvsa-o
- molecular-weight:
- 142.18
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- HISTIDPHOS-RXN
- [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
- HISTOLDEHYD-RXN
