Difference between revisions of "Nucleobases-in-DNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ARACHIDONIC_ACID == * common-name: ** arachidonate * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)[o-] * inchi-key: ** yzxbapsdxzzrgb-dofzraljs...") |
(Created page with "Category:metabolite == Metabolite Nucleobases-in-DNA == * common-name: ** a nucleobase within dna == Reaction(s) known to consume the compound == == Reaction(s) known to p...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Nucleobases-in-DNA == |
* common-name: | * common-name: | ||
− | ** | + | ** a nucleobase within dna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12353]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a nucleobase within dna}} |
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Nucleobases-in-DNA
- common-name:
- a nucleobase within dna