Difference between revisions of "Nucleobases-in-DNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17371 == * common-name: ** 18-hydroxylinoleoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite Nucleobases-in-DNA == * common-name: ** a nucleobase within dna == Reaction(s) known to consume the compound == == Reaction(s) known to p...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17371 ==
+
== Metabolite Nucleobases-in-DNA ==
 
* common-name:
 
* common-name:
** 18-hydroxylinoleoyl-coa
+
** a nucleobase within dna
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** hjegylshikpenr-daxvlclxsa-j
 
* molecular-weight:
 
** 1041.936
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16118]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12353]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=18-hydroxylinoleoyl-coa}}
+
{{#set: common-name=a nucleobase within dna}}
{{#set: inchi-key=inchikey=hjegylshikpenr-daxvlclxsa-j}}
 
{{#set: molecular-weight=1041.936}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite Nucleobases-in-DNA

  • common-name:
    • a nucleobase within dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality