Difference between revisions of "Nucleobases-in-DNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16879 == * transcription-direction: ** positive * right-end-position: ** 215014 * left-end-position: ** 212258 * centisome-position: ** 76.98763...")
(Created page with "Category:metabolite == Metabolite ARACHIDONIC_ACID == * common-name: ** arachidonate * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)[o-] * inchi-key: ** yzxbapsdxzzrgb-dofzraljs...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ16879 ==
+
== Metabolite ARACHIDONIC_ACID ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** arachidonate
−
* right-end-position:
+
* smiles:
−
** 215014
+
** cccccc=ccc=ccc=ccc=ccccc(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 212258
+
** yzxbapsdxzzrgb-dofzraljsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 76.98763   
+
** 303.464
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ARACHIDONATE-15-LIPOXYGENASE-RXN]]
−
== Reaction(s) associated ==
+
* [[ARACHIDONATE-5-LIPOXYGENASE-RXN]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-13395]]
−
* [[GSHTRAN-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-16016]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN6666-2]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=arachidonate}}
−
* [[GST-RXN]]
+
{{#set: inchi-key=inchikey=yzxbapsdxzzrgb-dofzraljsa-m}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=303.464}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-13673]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-15680]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6842]]
 
−
** '''5''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-4061]]
 
−
** '''4''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7112]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7533]]
 
−
** '''3''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=215014}}
 
−
{{#set: left-end-position=212258}}
 
−
{{#set: centisome-position=76.98763    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:32, 18 December 2020

Metabolite ARACHIDONIC_ACID

  • common-name:
    • arachidonate
  • smiles:
    • cccccc=ccc=ccc=ccc=ccccc(=o)[o-]
  • inchi-key:
    • yzxbapsdxzzrgb-dofzraljsa-m
  • molecular-weight:
    • 303.464

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Nucleobases-in-DNA&oldid=46261"