Difference between revisions of "Nucleoside-Triphosphates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1063 == * common-name: ** 5-(methylthio)ribulose 1-phosphate * smiles: ** cscc(o)c(o)c(=o)cop([o-])(=o)[o-] * inchi-key: ** cnsjryumv...") |
(Created page with "Category:metabolite == Metabolite 5-METHYL-THF-GLU-N == * common-name: ** a 5-methyltetrahydrofolate == Reaction(s) known to consume the compound == * [[HOMOCYSMETB12-RXN]...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-METHYL-THF-GLU-N == |
* common-name: | * common-name: | ||
− | ** 5- | + | ** a 5-methyltetrahydrofolate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[HOMOCYSMETB12-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[5 | + | * [[1.5.1.20-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=5- | + | {{#set: common-name=a 5-methyltetrahydrofolate}} |
− | |||
− |
Revision as of 18:58, 14 January 2021
Contents
Metabolite 5-METHYL-THF-GLU-N
- common-name:
- a 5-methyltetrahydrofolate