Difference between revisions of "Nucleoside-Triphosphates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6994 == * common-name: ** (2s)-eriodictyol * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3)o)o) * inchi-key: ** sbhxy...") |
(Created page with "Category:metabolite == Metabolite 3-oxo-cis-D9-hexadecenoyl-ACPs == * common-name: ** a 3-oxo-cis-δ9-hexadecenoyl-[acp] == Reaction(s) known to consume the compound...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-oxo-cis-D9-hexadecenoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 3-oxo-cis-δ9-hexadecenoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10659]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10658]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 3-oxo-cis-δ9-hexadecenoyl-[acp]}} |
| − | |||
| − | |||
Revision as of 08:30, 15 March 2021
Contents
Metabolite 3-oxo-cis-D9-hexadecenoyl-ACPs
- common-name:
- a 3-oxo-cis-δ9-hexadecenoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 3-oxo-cis-δ9-hexadecenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
