Difference between revisions of "O-ACETYLCARNITINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11815 == * transcription-direction: ** negative * right-end-position: ** 318368 * left-end-position: ** 310584 * centisome-position: ** 84.72521...")
(Created page with "Category:metabolite == Metabolite O-ACETYLCARNITINE == * common-name: ** o-acetyl-l-carnitine * smiles: ** cc(=o)oc(cc(=o)[o-])c[n+](c)(c)c * inchi-key: ** rdhqfkqigngied-...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ11815 ==
+
== Metabolite O-ACETYLCARNITINE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** o-acetyl-l-carnitine
−
* right-end-position:
+
* smiles:
−
** 318368
+
** cc(=o)oc(cc(=o)[o-])c[n+](c)(c)c
−
* left-end-position:
+
* inchi-key:
−
** 310584
+
** rdhqfkqigngied-mrvpvssysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 84.72521   
+
** 203.238
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[6PGLUCONDEHYDROG-RXN]]
+
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=o-acetyl-l-carnitine}}
−
* [[PYRROLINECARBREDUCT-RXN]]
+
{{#set: inchi-key=inchikey=rdhqfkqigngied-mrvpvssysa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=203.238}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-9952]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN66-546]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[P122-PWY]]
 
−
** '''16''' reactions found over '''18''' reactions in the full pathway
 
−
* [[PWY-3341]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PROSYN-PWY]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6344]]
 
−
** '''2''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-4981]]
 
−
** '''3''' reactions found over '''6''' reactions in the full pathway
 
−
* [[ARG-PRO-PWY]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[OXIDATIVEPENT-PWY]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=318368}}
 
−
{{#set: left-end-position=310584}}
 
−
{{#set: centisome-position=84.72521    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=7}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite O-ACETYLCARNITINE

  • common-name:
    • o-acetyl-l-carnitine
  • smiles:
    • cc(=o)oc(cc(=o)[o-])c[n+](c)(c)c
  • inchi-key:
    • rdhqfkqigngied-mrvpvssysa-n
  • molecular-weight:
    • 203.238

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=O-ACETYLCARNITINE&oldid=137369"