Difference between revisions of "O-ACETYLCARNITINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-308 == * common-name: ** d-nopaline * smiles: ** c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o * inchi-key: ** lmkyzbgvkhtlt...") |
(Created page with "Category:metabolite == Metabolite O-ACETYLCARNITINE == * common-name: ** o-acetyl-l-carnitine * smiles: ** cc(=o)oc(cc(=o)[o-])c[n+](c)(c)c * inchi-key: ** rdhqfkqigngied-...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite O-ACETYLCARNITINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** o-acetyl-l-carnitine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=o)oc(cc(=o)[o-])c[n+](c)(c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rdhqfkqigngied-mrvpvssysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 203.238 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[CARNITINE-O-ACETYLTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[CARNITINE-O-ACETYLTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=o-acetyl-l-carnitine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rdhqfkqigngied-mrvpvssysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=203.238}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite O-ACETYLCARNITINE
- common-name:
- o-acetyl-l-carnitine
- smiles:
- cc(=o)oc(cc(=o)[o-])c[n+](c)(c)c
- inchi-key:
- rdhqfkqigngied-mrvpvssysa-n
- molecular-weight:
- 203.238
