Difference between revisions of "O-PHOSPHO-L-HOMOSERINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ16951 == * transcription-direction: ** negative * right-end-position: ** 538003 * left-end-position: ** 526782 * centisome-position: ** 77.240425...") |
(Created page with "Category:metabolite == Metabolite O-PHOSPHO-L-HOMOSERINE == * common-name: ** o-phospho-l-homoserine * smiles: ** c(cop([o-])(=o)[o-])c([n+])c([o-])=o * inchi-key: ** fxdn...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite O-PHOSPHO-L-HOMOSERINE == |
− | * | + | * common-name: |
− | ** | + | ** o-phospho-l-homoserine |
− | + | * smiles: | |
− | + | ** c(cop([o-])(=o)[o-])c([n+])c([o-])=o | |
− | + | * inchi-key: | |
− | + | ** fxdnyoanaxwzhg-vkhmyheasa-l | |
− | * | + | * molecular-weight: |
− | ** | + | ** 197.084 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[CYSPH-RXN]] | |
− | = | + | * [[RXN-12728]] |
− | + | * [[THRESYN-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[HOMOSERKIN-RXN]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=o-phospho-l-homoserine}} | |
− | ** | + | {{#set: inchi-key=inchikey=fxdnyoanaxwzhg-vkhmyheasa-l}} |
− | + | {{#set: molecular-weight=197.084}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite O-PHOSPHO-L-HOMOSERINE
- common-name:
- o-phospho-l-homoserine
- smiles:
- c(cop([o-])(=o)[o-])c([n+])c([o-])=o
- inchi-key:
- fxdnyoanaxwzhg-vkhmyheasa-l
- molecular-weight:
- 197.084