Difference between revisions of "O-PHOSPHO-L-HOMOSERINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-terminal-L-cysteine == * common-name: ** an n-terminal l-cysteinyl-[protein] == Reaction(s) known to consume the compound == == Reactio...") |
(Created page with "Category:metabolite == Metabolite O-PHOSPHO-L-HOMOSERINE == * common-name: ** o-phospho-l-homoserine * smiles: ** c(cop([o-])(=o)[o-])c([n+])c([o-])=o * inchi-key: ** fxdn...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite O-PHOSPHO-L-HOMOSERINE == |
* common-name: | * common-name: | ||
− | ** | + | ** o-phospho-l-homoserine |
+ | * smiles: | ||
+ | ** c(cop([o-])(=o)[o-])c([n+])c([o-])=o | ||
+ | * inchi-key: | ||
+ | ** fxdnyoanaxwzhg-vkhmyheasa-l | ||
+ | * molecular-weight: | ||
+ | ** 197.084 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[CYSPH-RXN]] | ||
+ | * [[RXN-12728]] | ||
+ | * [[THRESYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[HOMOSERKIN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=o-phospho-l-homoserine}} |
+ | {{#set: inchi-key=inchikey=fxdnyoanaxwzhg-vkhmyheasa-l}} | ||
+ | {{#set: molecular-weight=197.084}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite O-PHOSPHO-L-HOMOSERINE
- common-name:
- o-phospho-l-homoserine
- smiles:
- c(cop([o-])(=o)[o-])c([n+])c([o-])=o
- inchi-key:
- fxdnyoanaxwzhg-vkhmyheasa-l
- molecular-weight:
- 197.084