Difference between revisions of "O-SINAPOYLCHOLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11352 == * transcription-direction: ** negative * right-end-position: ** 64115 * left-end-position: ** 51986 * centisome-position: ** 13.92338...")
 
(Created page with "Category:metabolite == Metabolite O-SINAPOYLCHOLINE == * common-name: ** o-sinapoylcholine * smiles: ** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c * inchi-key: ** hu...")
 
(9 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ11352 ==
+
== Metabolite O-SINAPOYLCHOLINE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** o-sinapoylcholine
−
* right-end-position:
+
* smiles:
−
** 64115
+
** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c
−
* left-end-position:
+
* inchi-key:
−
** 51986
+
** hujxhfrxwwgyqh-uhfffaoysa-o
−
* centisome-position:
+
* molecular-weight:
−
** 13.92338   
+
** 310.369
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[2.3.1.91-RXN]]
−
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=o-sinapoylcholine}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=hujxhfrxwwgyqh-uhfffaoysa-o}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=310.369}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-17203]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-18301]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-18303]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7840]]
 
−
** '''3''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=64115}}
 
−
{{#set: left-end-position=51986}}
 
−
{{#set: centisome-position=13.92338    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite O-SINAPOYLCHOLINE

  • common-name:
    • o-sinapoylcholine
  • smiles:
    • c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c
  • inchi-key:
    • hujxhfrxwwgyqh-uhfffaoysa-o
  • molecular-weight:
    • 310.369

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=O-SINAPOYLCHOLINE&oldid=137766"