Difference between revisions of "O-SUCCINYL-L-HOMOSERINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-hydroxybenzoate == * common-name: ** 4-hydroxybenzoate * smiles: ** c(c1(c=cc(=cc=1)o))(=o)[o-] * inchi-key: ** fjkrolugyxjwqn-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite O-SUCCINYL-L-HOMOSERINE == * common-name: ** o-succinyl-l-homoserine * smiles: ** c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o * inchi-key: ** g...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite O-SUCCINYL-L-HOMOSERINE == |
* common-name: | * common-name: | ||
− | ** | + | ** o-succinyl-l-homoserine |
* smiles: | * smiles: | ||
− | ** c( | + | ** c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** gnisqjgxjidkdj-yfkpbyrvsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 218.186 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[METBALT-RXN]] |
− | * [[RXN- | + | * [[O-SUCCHOMOSERLYASE-RXN]] |
+ | * [[RXN-9384]] | ||
+ | * [[SUCHMSSELCYSL]] | ||
+ | * [[SUCHMSSELCYSLh]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[HOMSUCTRAN-RXN]] | ||
+ | * [[O-SUCCHOMOSERLYASE-RXN]] | ||
+ | * [[RXN-9384]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=o-succinyl-l-homoserine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gnisqjgxjidkdj-yfkpbyrvsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=218.186}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite O-SUCCINYL-L-HOMOSERINE
- common-name:
- o-succinyl-l-homoserine
- smiles:
- c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o
- inchi-key:
- gnisqjgxjidkdj-yfkpbyrvsa-m
- molecular-weight:
- 218.186