Difference between revisions of "O-SUCCINYL-L-HOMOSERINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18748 == * transcription-direction: ** negative * right-end-position: ** 237866 * left-end-position: ** 233952 * centisome-position: ** 98.31982...") |
(Created page with "Category:metabolite == Metabolite O-SUCCINYL-L-HOMOSERINE == * common-name: ** o-succinyl-l-homoserine * smiles: ** c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o * inchi-key: ** g...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite O-SUCCINYL-L-HOMOSERINE == |
− | * | + | * common-name: |
− | ** | + | ** o-succinyl-l-homoserine |
− | * | + | * smiles: |
− | ** | + | ** c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o |
− | * | + | * inchi-key: |
− | ** | + | ** gnisqjgxjidkdj-yfkpbyrvsa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 218.186 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[METBALT-RXN]] |
− | == Reaction(s) | + | * [[O-SUCCHOMOSERLYASE-RXN]] |
− | * [[ | + | * [[RXN-9384]] |
− | * | + | * [[SUCHMSSELCYSL]] |
− | * | + | * [[SUCHMSSELCYSLh]] |
− | + | == Reaction(s) known to produce the compound == | |
− | {{#set: | + | * [[HOMSUCTRAN-RXN]] |
− | + | * [[O-SUCCHOMOSERLYASE-RXN]] | |
− | {{#set: | + | * [[RXN-9384]] |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=o-succinyl-l-homoserine}} | |
+ | {{#set: inchi-key=inchikey=gnisqjgxjidkdj-yfkpbyrvsa-m}} | ||
+ | {{#set: molecular-weight=218.186}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite O-SUCCINYL-L-HOMOSERINE
- common-name:
- o-succinyl-l-homoserine
- smiles:
- c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o
- inchi-key:
- gnisqjgxjidkdj-yfkpbyrvsa-m
- molecular-weight:
- 218.186