Difference between revisions of "O-SUCCINYL-L-HOMOSERINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Rhodopsins == * common-name: ** a rhodopsin == Reaction(s) known to consume the compound == * 2.7.11.14-RXN == Reaction(s) known to p...")
(Created page with "Category:metabolite == Metabolite O-SUCCINYL-L-HOMOSERINE == * common-name: ** o-succinyl-l-homoserine * smiles: ** c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o * inchi-key: ** g...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Rhodopsins ==
+
== Metabolite O-SUCCINYL-L-HOMOSERINE ==
 
* common-name:
 
* common-name:
** a rhodopsin
+
** o-succinyl-l-homoserine
 +
* smiles:
 +
** c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o
 +
* inchi-key:
 +
** gnisqjgxjidkdj-yfkpbyrvsa-m
 +
* molecular-weight:
 +
** 218.186
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.11.14-RXN]]
+
* [[METBALT-RXN]]
 +
* [[O-SUCCHOMOSERLYASE-RXN]]
 +
* [[RXN-9384]]
 +
* [[SUCHMSSELCYSL]]
 +
* [[SUCHMSSELCYSLh]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.11.14-RXN]]
+
* [[HOMSUCTRAN-RXN]]
 +
* [[O-SUCCHOMOSERLYASE-RXN]]
 +
* [[RXN-9384]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a rhodopsin}}
+
{{#set: common-name=o-succinyl-l-homoserine}}
 +
{{#set: inchi-key=inchikey=gnisqjgxjidkdj-yfkpbyrvsa-m}}
 +
{{#set: molecular-weight=218.186}}

Latest revision as of 11:12, 18 March 2021

Metabolite O-SUCCINYL-L-HOMOSERINE

  • common-name:
    • o-succinyl-l-homoserine
  • smiles:
    • c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o
  • inchi-key:
    • gnisqjgxjidkdj-yfkpbyrvsa-m
  • molecular-weight:
    • 218.186

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality